missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L(+)-Gulonic acid gamma-lactone, 95+%
CAS: 1128-23-0 | C6H10O6 | 178.14 g/mol
Supplier: Thermo Scientific Chemicals 255571000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L(+)-Gulonic acid γ-lactone | |
| 183.0°C to 185.0°C | |
| 0.5% max. (1 g, 105°C, 3 hrs) | |
| 95% min. (ELSD) (HPLC) | |
| C6H10O6 | |
| + 54.50 (57.50°C c=2,water) | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| C(C(C1C(C(C(=O)O1)O)O)O)O | |
| 178.14 | |
| CHEBI:17587 | |
| 95+% |
| 1128-23-0 | |
| 1.344g/mL | |
| Authentic | |
| Glass Bottle | |
| 100 g | |
| + 54.50 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one | |
| 439373 | |
| 178.14 | |
| Viscous Solution |
Chemical Identifiers
| 1128-23-0 | |
| 178.14 | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| CHEBI:17587 | |
| C(C(C1C(C(C(=O)O1)O)O)O)O |
| C6H10O6 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| 439373 | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
RUO – Research Use Only