missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L(+)-Gulonic acid gamma-lactone, 95+%
CAS: 1128-23-0 | C6H10O6 | 178.14 g/mol
Supplier: Thermo Scientific Chemicals 255570250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L(+)-Gulonic acid γ-lactone | |
| 183.0°C to 185.0°C | |
| Authentic | |
| Glass bottle | |
| 25 g | |
| + 54.50 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one | |
| 439373 | |
| 178.14 | |
| Viscous Solution |
| 1128-23-0 | |
| 0.5% max. (1 g, 105°C, 3 hrs) | |
| 95% min. (ELSD) (HPLC) | |
| C6H10O6 | |
| + 54.50 (57.50°C c=2,water) | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| C(C(C1C(C(C(=O)O1)O)O)O)O | |
| 178.14 | |
| CHEBI:17587 | |
| 95+% |
Chemical Identifiers
| 1128-23-0 | |
| 178.14 | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| CHEBI:17587 | |
| C(C(C1C(C(C(=O)O1)O)O)O)O |
| C6H10O6 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| 439373 | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
RUO – Research Use Only