missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Gulonic acid-1,4-lactone, 95%
CAS: 1128-23-0 | C6H10O6 | 178.14 g/mol
$93.92 - $358.36
Chemical Identifiers
| CAS | 1128-23-0 |
|---|---|
| Molecular Formula | C6H10O6 |
| Molecular Weight (g/mol) | 178.14 |
| MDL Number | MFCD00064331 |
| InChI Key | SXZYCXMUPBBULW-SKNVOMKLSA-N |
| Synonym | l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone |
| PubChem CID | 439373 |
| ChEBI | CHEBI:17587 |
| IUPAC Name | (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| SMILES | C(C(C1C(C(C(=O)O1)O)O)O)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAJ6693406
|
Thermo Scientific Chemicals
J6693406 |
5 g |
Each for $93.92
|
|
|||||
|
AAJ6693414
|
Thermo Scientific Chemicals
J6693414 |
25 g |
Each for $358.36
|
|
|||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1128-23-0 | |
| 178.14 | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| 439373 | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one |
| C6H10O6 | |
| MFCD00064331 | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| CHEBI:17587 | |
| C(C(C1C(C(C(=O)O1)O)O)O)O |
Specifications
| 1128-23-0 | |
| White | |
| MFCD00064331 | |
| 83002 | |
| Soluble in water | |
| +54.5° (c=4 in Water) | |
| (3S,4R,5R)-5-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxyoxolan-2-one | |
| 439373 | |
| 178.14 | |
| Powder |
| 184°C to 190°C | |
| C6H10O6 | |
| 5 g | |
| l-gulonolactone, l-gulono-1,4-lactone, l-gulonic acid gamma-lactone, 3s,4r,5r-5-s-1,2-dihydroxyethyl-3,4-dihydroxydihydrofuran-2 3h-one, l-gulono-gamma-lactone, gamma-gulonolactone, l-gulonic gamma-lactone, l-+-gulono-1,4-lactone, l +-gulonic acid gamma-lactone, l-+-gulonic acid gamma-lactone | |
| SXZYCXMUPBBULW-SKNVOMKLSA-N | |
| C(C(C1C(C(C(=O)O1)O)O)O)O | |
| 178.14 | |
| CHEBI:17587 | |
| 95% | |
| L-Gulonic acid-1,4-lactone |
Safety and Handling
TSCA : No
Recommended Storage : Keep cold
RUO – Research Use Only