missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Glutathione, Reduced, 98.0-101.0%, Spectrum™ Chemical
Supplier: Spectrum Chemical Mfg Cor GL14625GM
Specifications
| 70-18-8 | |
| 0.001 | |
| Amber Glass Bottle | |
| 25 g | |
| RWSXRVCMGQZWBV-UHFFFAOYNA-N | |
| 2-amino-4-({1-[(carboxymethyl)carbamoyl]-2-sulfanylethyl}carbamoyl)butanoic acid | |
| 98 to 101% |
| 1 | |
| 0.005 | |
| C10H17N3O6S | |
| -17.5° to -15.5° | |
| NC(CCC(=O)NC(CS)C(=O)NCC(O)=O)C(O)=O | |
| 307.32 | |
| Reagent |
Chemical Identifiers
| 70-18-8 | |
| 307.32 | |
| 2-amino-4-({1-[(carboxymethyl)carbamoyl]-2-sulfanylethyl}carbamoyl)butanoic acid |
| C10H17N3O6S | |
| RWSXRVCMGQZWBV-UHFFFAOYNA-N | |
| NC(CCC(=O)NC(CS)C(=O)NCC(O)=O)C(O)=O |
CAUTION: For manufacturing, processing or repacking. Read and understand the label and Safety Data Sheet (SDS) prior to use.