Learn More
L-Glutamic acid dimethyl ester hydrochloride, 98+%
CAS: 23150-65-4 | C7H13ClNO4 | 210.63 g/mol
Supplier: Thermo Scientific Chemicals L0376414
| Quantity | 25 g |
|---|
Description
L-Glutamic acid dimethyl ester hydrochloride is used as a pharmaceutical intermediate.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsL-Glutamic acid dimethyl ester hydrochloride is used as a pharmaceutical intermediate.
Solubility
Soluble in water, methanol (50 mg/ml).
Notes
Hygroscopic. Store under inert gas. Store away from oxidizing agents, water/ moisture, heat.
Chemical Identifiers
| 23150-65-4 | |
| 210.63 | |
| BPHCSYSXOKTCMA-UHFFFAOYNA-N | |
| 12917568 | |
| [Cl].COC(=O)CCC(N)C(=O)OC |
| C7H13ClNO4 | |
| MFCD00038879 | |
| l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride | |
| dimethyl (2S)-2-aminopentanedioate;hydrochloride |
Specifications
| 99°C to 103°C | |
| 23150-65-4 | |
| MFCD00038879 | |
| l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride | |
| BPHCSYSXOKTCMA-UHFFFAOYNA-N | |
| dimethyl (2S)-2-aminopentanedioate;hydrochloride | |
| 210.63 | |
| Odorless | |
| +26° (c=5 in Water) | |
| Hygroscopic |
| L-Glutamic acid dimethyl ester hydrochloride | |
| C7H13ClNO4 | |
| 4238829 | |
| Soluble in water,methanol (50mg/ml). | |
| [Cl].COC(=O)CCC(N)C(=O)OC | |
| 25 g | |
| 12917568 | |
| 211.65 | |
| ≥98% |
Safety and Handling
EINECSNumber : 245-461-0
TSCA : No
Recommended Storage : Keep cold