Learn More
L(-)-Carvone, 99%
CAS: 6485-40-1 | C10H14O | 150.22 g/mol
Supplier: Thermo Scientific Chemicals 154591000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| L(-)-Carvone | |
| 6485-40-1 | |
| 0.9580g/mL | |
| 88°C | |
| 98.5% min. (GC) | |
| C10H14O | |
| MFCD00001578 | |
| 07, 157 | |
| 14, 1874 | |
| --carvone, l-carvone, r---carvone, l--carvone, r-2-methyl-5-prop-1-en-2-yl cyclohex-2-enone, 4r-carvone, levo-carvone, --p-mentha-6,8-dien-2-one, --r-carvone | |
| ULDHMXUKGWMISQ-SECBINFHSA-N | |
| (5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one | |
| 439570 | |
| 150.22 | |
| Liquid |
| 99+% | |
| Colorless to Yellow | |
| 227.0°C to 230.0°C | |
| Authentic | |
| Glass bottle | |
| 1.4950 to 1.5020 | |
| 100 g | |
| 0.958 | |
| − 57.00 | |
| Solubility in water: practically insoluble in water. Other solubilities: soluble in alcohol, ether, chloroform,, propylene glycol and mineral oils, insoluble in glycerol | |
| CC(=C)[C@@H]1CC=C(C)C(=O)C1 | |
| 150.22 | |
| CHEBI:15400 | |
| 99% |
Chemical Identifiers
| 6485-40-1 | |
| 150.22 | |
| ULDHMXUKGWMISQ-SECBINFHSA-N | |
| 439570 | |
| (5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-one |
| C10H14O | |
| MFCD00001578 | |
| --carvone, l-carvone, r---carvone, l--carvone, r-2-methyl-5-prop-1-en-2-yl cyclohex-2-enone, 4r-carvone, levo-carvone, --p-mentha-6,8-dien-2-one, --r-carvone | |
| CHEBI:15400 | |
| CC(=C)[C@@H]1CC=C(C)C(=O)C1 |
Safety and Handling
GHS H Statement
May cause an allergic skin reaction.
GHS P Statement
Wear protective gloves/protective clothing.
GHS Signal Word: Warning
EINECSNumber : 229-352-5
RTECSNumber : OS8650000
TSCA : TSCA
RUO – Research Use Only