Learn More
L(-)-Camphorsulfonic acid, 98%
CAS: 35963-20-3 | C10H16O4S | 232.29 g/mol
$42.55 - $85.99
Chemical Identifiers
| CAS | 35963-20-3 |
|---|---|
| Molecular Formula | C10H16O4S |
| Molecular Weight (g/mol) | 232.29 |
| MDL Number | MFCD00150753,MFCD00064158 |
| InChI Key | MIOPJNTWMNEORI-MHPPCMCBSA-N |
| Synonym | l--camphorsulfonic acid, 1r,4s-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, 1r---camphor-10-sulfonic acid, unii-y6075i4fxe, camphorsulfonic acid,-, l---camphor-10-sulfonic acid, s-camphorsulfonic acid, 1r,4s-7,7-dimethyl-2-oxobicyclo 2.2.1 hept-1-yl methanesulfonic acid, --camphor-10-sulfonic acid |
| PubChem CID | 5771688 |
| ChEBI | CHEBI:55401 |
| SMILES | CC1(C)C2CC[C@]1(CS(O)(=O)=O)C(=O)C2 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC263640050
|
Thermo Scientific Chemicals
263640050 |
5 g | Glass bottle |
Each for $42.55
|
|
||||
|
AC263640250
|
Thermo Scientific Chemicals
263640250 |
25 g | Glass bottle |
Each for $85.99
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 35963-20-3 | |
| 232.29 | |
| MIOPJNTWMNEORI-MHPPCMCBSA-N | |
| 5771688 | |
| CC1(C)C2CC[C@]1(CS(O)(=O)=O)C(=O)C2 |
| C10H16O4S | |
| MFCD00150753,MFCD00064158 | |
| l--camphorsulfonic acid, 1r,4s-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, 1r---camphor-10-sulfonic acid, unii-y6075i4fxe, camphorsulfonic acid,-, l---camphor-10-sulfonic acid, s-camphorsulfonic acid, 1r,4s-7,7-dimethyl-2-oxobicyclo 2.2.1 hept-1-yl methanesulfonic acid, --camphor-10-sulfonic acid | |
| CHEBI:55401 |
Specifications
| 35963-20-3 | |
| White to Beige | |
| 98% | |
| C10H16O4S | |
| 5 g | |
| 16,58 | |
| l--camphorsulfonic acid, 1r,4s-7,7-dimethyl-2-oxobicyclo 2.2.1 heptan-1-yl methanesulfonic acid, 1r---camphor-10-sulfonic acid, unii-y6075i4fxe, camphorsulfonic acid,-, l---camphor-10-sulfonic acid, s-camphorsulfonic acid, 1r,4s-7,7-dimethyl-2-oxobicyclo 2.2.1 hept-1-yl methanesulfonic acid, --camphor-10-sulfonic acid | |
| MIOPJNTWMNEORI-MHPPCMCBSA-N | |
| [(1S,4R)-7,7-dimethyl-3-oxo-4-bicyclo[2.2.1]heptanyl]methanesulfonic acid | |
| 5771688 | |
| 232.3 | |
| Crystalline Powder |
| 198.0°C | |
| Authentic | |
| Glass bottle | |
| MFCD00150753,MFCD00064158 | |
| 11,316 | |
| − 22.00 | |
| Solubility in water: soluble. Other solubilities: slightly soluble in glacial acetic acid and ethyl,acetate,practically insoluble in ether,soluble in chloroform and alcohol | |
| CC1(C)C2CC[C@]1(CS(O)(=O)=O)C(=O)C2 | |
| 232.29 | |
| CHEBI:55401 | |
| 98% | |
| L(-)-Camphorsulfonic acid |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: Rinse mouth.
Do NOT induce vomiting.
Wear protective gloves/protective clothing/eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if pre
GHS Signal Word: Danger
EINECSNumber : 252-817-9
RUO – Research Use Only