missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals L-Aspartyl-L-phenylalanine methyl ester, 98%
CAS: 22839-47-0 | C14H18N2O5 | 294.31 g/mol
Supplier: Thermo Scientific Chemicals 228650250
| Quantity | 25 g |
|---|---|
| Packaging | Glass Bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 22839-47-0 | |
| 294.31 | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| 134601 | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid |
| C14H18N2O5 | |
| MFCD00002724 | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| CHEBI:2877 | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O |
Specifications
| 248.0°C to 250.0°C | |
| 22839-47-0 | |
| Authentic | |
| 98% | |
| C14H18N2O5 | |
| MFCD00002724 | |
| 95% min. (c=1, 2N HCl, 430nm) 1cm cell | |
| aspartame, nutrasweet, asp-phe-ome, asp-phe methyl ester, aspartam, aspartamum, aspartamo, l-aspartyl-l-phenylalanine methyl ester, aspartylphenylalanine methyl ester, dipeptide sweetener | |
| IAOZJIPTCAWIRG-QWRGUYRKSA-N | |
| + 12.50 (20.00°C c=4,15N formic acid) | |
| 25 g | |
| 134601 | |
| 294.3 | |
| Crystalline Powder |
| L-Aspartyl-L-phenylalanine methyl ester | |
| White | |
| 4.5% max. (105°C, 4 hrs) | |
| Glass Bottle | |
| HO2CCH2CH(NH2)CONHCH(CH2C6H5)CO2CH3 | |
| + 12.50 | |
| 15, 829 | |
| Solubility in water: sparingly soluble. | |
| COC(=O)[C@H](CC1=CC=CC=C1)NC(=O)[C@@H](N)CC(O)=O | |
| (3S)-3-amino-4-[[(2S)-1-methoxy-1-oxo-3-phenylpropan-2-yl]amino]-4-oxobutanoic acid | |
| 294.31 | |
| CHEBI:2877 | |
| 98% |
Safety and Handling
EINECSNumber : 245-261-3