missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Janus Green B, pure, high purity biological stain
CAS: 2869-83-2 | C30H31ClN6 | 511.07 g/mol
Supplier: Thermo Scientific Chemicals 191680050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Janus Green B | |
| 2869-83-2 | |
| C30H31ClN6 | |
| 15, 5303 | |
| Solubility in water: soluble. | |
| Authentic | |
| 8-[[4-(dimethylamino)phenyl]diazenyl]-N,N-diethyl-10-phenylphenazin-10-ium-2-amine;chloride | |
| 76123 | |
| 511.07 | |
| Glass bottle | |
| 5 g |
| Pure | |
| 50% min. | |
| MFCD00011758 | |
| C.I. 11050 | |
| XXACTDWGHQXLGW-UHFFFAOYSA-M | |
| [Cl-].CCN(CC)C1=CC=C2N=C3C=CC(=CC3=[N+](C3=CC=CC=C3)C2=C1)N=NC1=CC=C(C=C1)N(C)C | |
| 511.07 | |
| CHEBI:21184 | |
| Pure | |
| Black or Brown/Green | |
| Powder |
Chemical Identifiers
| 2869-83-2 | |
| 511.07 | |
| XXACTDWGHQXLGW-UHFFFAOYSA-M | |
| 76123 | |
| 8-[[4-(dimethylamino)phenyl]diazenyl]-N,N-diethyl-10-phenylphenazin-10-ium-2-amine;chloride |
| C30H31ClN6 | |
| MFCD00011758 | |
| C.I. 11050 | |
| CHEBI:21184 | |
| [Cl-].CCN(CC)C1=CC=C2N=C3C=CC(=CC3=[N+](C3=CC=CC=C3)C2=C1)N=NC1=CC=C(C=C1)N(C)C |
RUO – Research Use Only