Learn More
Isopropyl-β-D-thiogalactopyranoside (IPTG) (Wht. Powd., Dioxane Crystalline), Fisher BioReagents™
$101.10 - $101.10
Chemical Identifiers
| CAS | 367-93-1 |
|---|---|
| Molecular Formula | C9H18O5S |
| Molecular Weight (g/mol) | 238.30 |
| MDL Number | MFCD00063273 |
| InChI Key | BPHPUYQFMNQIOC-NXRLNHOXSA-N |
| Synonym | dioxane, p-dioxane, 1,4-diethylene dioxide, diethylene ether, dioxan, 1,4-dioxacyclohexane, diethylene dioxide, dioxanne, di ethylene oxide, tetrahydro-p-dioxin |
| PubChem CID | 31275 |
| ChEBI | CHEBI:47032 |
| IUPAC Name | 1,4-dioxane |
| SMILES | CC(C)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
BP1620-1
|
Fisher BioReagents
BP16201 |
1 g | Glass Bottle |
Each for $101.10
|
|
||||
Chemical Identifiers
| 367-93-1 | |
| 238.30 | |
| BPHPUYQFMNQIOC-NXRLNHOXSA-N | |
| 31275 | |
| 1,4-dioxane |
| C9H18O5S | |
| MFCD00063273 | |
| dioxane, p-dioxane, 1,4-diethylene dioxide, diethylene ether, dioxan, 1,4-dioxacyclohexane, diethylene dioxide, dioxanne, di ethylene oxide, tetrahydro-p-dioxin | |
| CHEBI:47032 | |
| CC(C)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
Specifications
| 122°C | |
| White | |
| Glass Bottle | |
| C9H18O5S | |
| 15, 5126 | |
| BPHPUYQFMNQIOC-NXRLNHOXSA-N | |
| 1,4-dioxane | |
| 31275 | |
| 238.3 |
| 367-93-1 | |
| 1 g | |
| Solid | |
| MFCD00063273 | |
| dioxane, p-dioxane, 1,4-diethylene dioxide, diethylene ether, dioxan, 1,4-dioxacyclohexane, diethylene dioxide, dioxanne, di ethylene oxide, tetrahydro-p-dioxin | |
| CC(C)S[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O | |
| 238.30 | |
| CHEBI:47032 | |
| Isopropyl-β-D-thiogalactopyranoside |
Safety and Handling
WARNING!
Emergency Overview
May form explosive peroxides. May cause skin, eye, and respiratory tract irritation. Use personal protective equipment. If peroxide formation is suspected, do not open or move container. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Get medical attention immediately if symptoms occur. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Obtain medical attention. Move to fresh air. If breathing is difficult, give oxygen. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Get medical attention immediately if symptoms occur.
NFPA
Health:2
Flammability:1
Instability:2
Recommended Storage : -20°C