Learn More
Isophthaloyl dichloride, 98%
CAS: 99-63-8 | C8H4Cl2O2 | 203.02 g/mol
Supplier: Thermo Scientific Chemicals 122661000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Isophthaloyl dichloride | |
| 43.0°C to 45.0°C | |
| 276.0°C | |
| Authentic | |
| Glass bottle | |
| C6H4(COCl)2 | |
| 09,IV,3295 | |
| Solubility in water: reacts. Other solubilities: reacts with alcohol,soluble in ether and other organic solvents | |
| C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl | |
| 203.02 | |
| 203.02 | |
| Crystalline Mass |
| 99-63-8 | |
| White | |
| 180°C | |
| 98% | |
| C8H4Cl2O2 | |
| 100 g | |
| isophthaloyl chloride, isophthaloyl dichloride, 1,3-benzenedicarbonyl dichloride, m-phthaloyl chloride, isophthalic chloride, isophthalic acid chloride, isophthalic acid dichloride, isothaloyl chloride, isophthalyl chloride, 1,3-benzenedicarbonyl chloride | |
| FDQSRULYDNDXQB-UHFFFAOYSA-N | |
| benzene-1,3-dicarbonyl chloride | |
| 7451 | |
| 98% |
Chemical Identifiers
| 99-63-8 | |
| 203.02 | |
| isophthaloyl chloride, isophthaloyl dichloride, 1,3-benzenedicarbonyl dichloride, m-phthaloyl chloride, isophthalic chloride, isophthalic acid chloride, isophthalic acid dichloride, isothaloyl chloride, isophthalyl chloride, 1,3-benzenedicarbonyl chloride | |
| benzene-1,3-dicarbonyl chloride |
| C8H4Cl2O2 | |
| FDQSRULYDNDXQB-UHFFFAOYSA-N | |
| 7451 | |
| C1=CC(=CC(=C1)C(=O)Cl)C(=O)Cl |
Safety and Handling
GHS H Statement
Harmful in contact with skin.
Toxic if inhaled.
Causes severe skin burns and eye damage.
GHS P Statement
Wear protective gloves/protective clothing/eye protection/face protection.
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Do not breathe dust/fume/gas/mist/vapors/spray.
IF IN EYES: Rinse cautiously with water
GHS Signal Word: Danger
EINECSNumber : 202-774-7
RUO – Research Use Only