missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Isobornyl Acrylate (stabilized with MEHQ) 90.0+%, TCI America™
Supplier: TCI America I063825G
Specifications
| Isobornyl Acrylate (stabilized with MEHQ) | |
| Yellow | |
| C13H20O2 | |
| 25 g | |
| isobornyl acrylate, acrylic acid isobornyl ester, 1,7,7-trimethyltricyclo 2.2.1 hepten-2-yl-2-propenoate | |
| CC1(C)[C@H]2CC[C@]1(C)C(C2)OC(=O)C=C | |
| 208.30 | |
| 208.30 | |
| Liquid |
| 5888-33-5 | |
| 104°C | |
| MFCD00080424 | |
| 3082 | |
| PSGCQDPCAWOCSH-BOURZNODSA-N | |
| (1S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl prop-2-enoate | |
| 122130333 | |
| ≥90.0% (GC) |
Chemical Identifiers
| 5888-33-5 | |
| 208.30 | |
| PSGCQDPCAWOCSH-BOURZNODSA-N | |
| 122130333 | |
| CC1(C)[C@H]2CC[C@]1(C)C(C2)OC(=O)C=C |
| C13H20O2 | |
| MFCD00080424 | |
| isobornyl acrylate, acrylic acid isobornyl ester, 1,7,7-trimethyltricyclo 2.2.1 hepten-2-yl-2-propenoate | |
| (1S,4S)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-yl prop-2-enoate |
Safety and Handling
RTECSNumber : UD3940000
TSCA : Yes