missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Isatin, 98%
CAS: 91-56-5 | C8H5NO2 | 147.13 g/mol
Supplier: Thermo Scientific Chemicals 151491000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Isatin | |
| 91-56-5 | |
| Orange | |
| Authentic | |
| Glass bottle | |
| MFCD00005718 | |
| 21, 432 | |
| isatin, indoline-2,3-dione, 2,3-indolinedione, indole-2,3-dione, isatine, 2,3-dioxoindoline, pseudoisatin, tribulin, isotin, isatic acid lactam | |
| JXDYKVIHCLTXOP-UHFFFAOYSA-N | |
| 1H-indole-2,3-dione | |
| 7054 | |
| 147.13 | |
| Powder |
| 98% | |
| 201°C to 204°C | |
| 220°C | |
| 98% | |
| C8H5NO2 | |
| 100 g | |
| 15, 5148 | |
| Solubility in water: 1.9g/L. Other solubilities: soluble in alkali hydroxide solutions,soluble in ethanol,diethyl ether,benzene | |
| C1=CC=C2C(=C1)C(=O)C(=O)N2 | |
| 147.13 | |
| CHEBI:27539 | |
| 98% |
Chemical Identifiers
| 91-56-5 | |
| 147.13 | |
| JXDYKVIHCLTXOP-UHFFFAOYSA-N | |
| 7054 | |
| 1H-indole-2,3-dione |
| C8H5NO2 | |
| MFCD00005718 | |
| isatin, indoline-2,3-dione, 2,3-indolinedione, indole-2,3-dione, isatine, 2,3-dioxoindoline, pseudoisatin, tribulin, isotin, isatic acid lactam | |
| CHEBI:27539 | |
| C1=CC=C2C(=C1)C(=O)C(=O)N2 |
Safety and Handling
EINECSNumber : 202-077-8
RTECSNumber : NL7873000
TSCA : TSCA
RUO – Research Use Only