missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Indole-3-Butyric Acid Potassium Salt, MP Biomedicals™
Synonym: K-IBA, Potassium 4-(1H-Indol-3-yl)butanoate, 1H-Indole-3-Butanoic Acid Potassium Salt
$66.32 - $66.32
Chemical Identifiers
| Molecular Formula | C12H12KNO2 |
|---|---|
| Molecular Weight (g/mol) | 241.331 |
| MDL Number | MFCD00058442 |
| InChI Key | KTWDHJYSJOSTSJ-UHFFFAOYSA-M |
| Synonym | potassium 4-1h-indol-3-yl butanoate, indole-3-butyric acid potassium salt, indole-3-butyric acid potassium, 4-indol-3-ylbutanoic acid, potassium salt, potassium indolebutyrate, pubchem22140, cambridge id 5119461, potassium ion indole-3 butyrate, indole-3-butyric acid-potassium salt, 3-indole butyric acid, potassium salt |
| PubChem CID | 23664348 |
| IUPAC Name | potassium;4-(1H-indol-3-yl)butanoate |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCCC(=O)[O-].[K+] |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
ICN10204301
|
MP Biomedicals Inc
0210204301 |
1 g |
Each for $66.32
|
|
|||||
Description
Water-soluble form of IBA, an auxin-family plant growth hormone.
- Promotes root organogenesis
- Induces callus formation
- Forms adventitious roots
- Aids in regulation of gravitropism and phototropism
Chemical Identifiers
| C12H12KNO2 | |
| MFCD00058442 | |
| potassium 4-1h-indol-3-yl butanoate, indole-3-butyric acid potassium salt, indole-3-butyric acid potassium, 4-indol-3-ylbutanoic acid, potassium salt, potassium indolebutyrate, pubchem22140, cambridge id 5119461, potassium ion indole-3 butyrate, indole-3-butyric acid-potassium salt, 3-indole butyric acid, potassium salt | |
| potassium;4-(1H-indol-3-yl)butanoate |
| 241.331 | |
| KTWDHJYSJOSTSJ-UHFFFAOYSA-M | |
| 23664348 | |
| C1=CC=C2C(=C1)C(=CN2)CCCC(=O)[O-].[K+] |
Specifications
| 60096-23-3 | |
| MFCD00058442 | |
| potassium 4-1h-indol-3-yl butanoate, indole-3-butyric acid potassium salt, indole-3-butyric acid potassium, 4-indol-3-ylbutanoic acid, potassium salt, potassium indolebutyrate, pubchem22140, cambridge id 5119461, potassium ion indole-3 butyrate, indole-3-butyric acid-potassium salt, 3-indole butyric acid, potassium salt | |
| C1=CC=C2C(=C1)C(=CN2)CCCC(=O)[O-].[K+] | |
| 241.331 | |
| Powder |
| C12H12KNO2 | |
| 1 g | |
| KTWDHJYSJOSTSJ-UHFFFAOYSA-M | |
| potassium;4-(1H-indol-3-yl)butanoate | |
| 23664348 |
Unless specified otherwise, MP Biomedical™'s products are for research or further manufacturing use only, not for direct human use.