missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Hygromycin B Solution, ≥80%, MP Biomedicals™
An aminoglycoside antibiotic produced by the bacterium Streptomyces hygroscopicus that kills bacteria, fungi and higher eukaryotic cells by inhibiting protein synthesis
Supplier: MP Biomedicals Inc 0215751394
Specifications
| Hygromycin B Solution | |
| Yellow | |
| C20H37N3O13 | |
| 5 mU | |
| GRRNUXAQVGOGFE-BBMONYMYSA-N | |
| (3'S,3aS,4S,4'S,5'R,6R,6'R,7R,7aS)-4-[(1R,2S,3R,5S,6S)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,2'-oxane]-3',4',5',7-tetrol | |
| 134129613 | |
| Liquid |
| 31282-04-9 | |
| ≥80% | |
| MFCD06795479 | |
| hygromycin b | |
| CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N | |
| 527.524 | |
| 527.5 |
Chemical Identifiers
| 31282-04-9 | |
| 527.524 | |
| GRRNUXAQVGOGFE-BBMONYMYSA-N | |
| 134129613 | |
| CNC1CC(C(C(C1O)OC2C3C(C(C(O2)CO)O)OC4(O3)C(C(C(C(O4)C(CO)N)O)O)O)O)N |
| C20H37N3O13 | |
| MFCD06795479 | |
| hygromycin b | |
| (3'S,3aS,4S,4'S,5'R,6R,6'R,7R,7aS)-4-[(1R,2S,3R,5S,6S)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)spiro[4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-2,2'-oxane]-3',4',5',7-tetrol |