Learn More
Hydroxypropyl methylcellulose
CAS: 9004-65-3 | C56H108O30 | 1261.45 g/mol
Supplier: Thermo Scientific Chemicals 044779A1
| Quantity | 1 kg |
|---|
Description
Hydroxypropyl methylcellulose is used as an ophthalmic lubricant, an emulsifier and a thickening and suspending agent. It is widely used as an excipient in pharmaceutical formulations. It acts as a food additive. Its eye drops are known as artificial tears, which are used to relieve eye dryness and soreness. It finds applications in various fields as tile adhesives, gypsum products, cosmetics, cement renders, contact lenses, detergents and cleaners.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 9004-65-3 | |
| 1261.45 | |
| PUSNGFYSTWMJSK-GSZQVNRLSA-N | |
| 57503849 | |
| CC(COCC1C(C(C(C(O1)OC2C(OC(C(C2OCC(C)O)OCC(C)O)OCC(C)O)COCC(C)O)OCC(C)O)OCC(C)O)OCC(C)O)O.COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC |
| C56H108O30 | |
| MFCD00131360 | |
| Methocel; HPMC | |
| (2R,3R,4S,5R,6R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane;1-[[(2R,3R,4S,5R,6S)-3,4,5-tris(2-hydroxypropoxy)-6-[(2R,3R,4S,5R,6R)-4,5,6-tris(2-hydroxypropoxy)-2-(2-hydroxypropoxymethyl)oxan- |
Specifications
| Hydroxypropyl methylcellulose | |
| C56H108O30 | |
| MFCD00131360 | |
| Methocel; HPMC | |
| PUSNGFYSTWMJSK-GSZQVNRLSA-N | |
| (2R,3R,4S,5R,6R)-2,3,4-trimethoxy-6-(methoxymethyl)-5-[(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxyoxane;1-[[(2R,3R,4S,5R,6S)-3,4,5-tris(2-hydroxypropoxy)-6-[(2R,3R,4S,5R,6R)-4,5,6-tris(2-hydroxypropoxy)-2-(2-hydroxypropoxymethyl)oxan- | |
| 57503849 |
| 9004-65-3 | |
| 1 kg | |
| 14,4842 | |
| Soluble in water. Slightly soluble in ethanol,ether,acetone and organic solvents. | |
| CC(COCC1C(C(C(C(O1)OC2C(OC(C(C2OCC(C)O)OCC(C)O)OCC(C)O)COCC(C)O)OCC(C)O)OCC(C)O)OCC(C)O)O.COCC1C(C(C(C(O1)OC2C(OC(C(C2OC)OC)OC)COC)OC)OC)OC | |
| 1261.45 | |
| Powder |
Safety and Handling
TSCA : Yes
Recommended Storage : Ambient temperatures