missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Hexafluorobenzene, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 120541000
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Hexafluorobenzene | |
| 1.6120g/mL | |
| 10°C | |
| 98.5% min. (GC) | |
| C6F6 | |
| C6F6 | |
| 100mL | |
| 15,4722 | |
| Solubility in water: immiscible. Other solubilities: soluble in ethanol | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F | |
| 186.06 | |
| CHEBI:38589 | |
| 99% |
| 392-56-3 | |
| 81.0°C to 82.0°C (743.0mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.3760 to 1.3780 | |
| MFCD00000288 | |
| 1.612 | |
| hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 1,2,3,4,5,6-hexafluorobenzene | |
| 9805 | |
| 186.06 |
Chemical Identifiers
| 392-56-3 | |
| 186.06 | |
| ZQBFAOFFOQMSGJ-UHFFFAOYSA-N | |
| 9805 | |
| 1,2,3,4,5,6-hexafluorobenzene |
| C6F6 | |
| MFCD00000288 | |
| hexafluorobenzene, perfluorobenzene, benzene, hexafluoro, hexafluorbenzol, unii-cmc18t611k, benzene, 1,2,3,4,5,6-hexafluoro, hexa fluorobenzene, hexafluoro benzene, pubchem18879, acmc-1bmus | |
| CHEBI:38589 | |
| C1(=C(C(=C(C(=C1F)F)F)F)F)F |
Safety and Handling
GHS H Statement
Highly flammable liquid and vapor.
GHS P Statement
Keep away from heat/sparks/open flames/hot surfaces.
- No smoking.
Ground/Bond container and receiving equipment.
GHS Signal Word: Danger
EINECSNumber : 206-876-2
RUO â Research Use Only