Learn More
Heptafluorobutyric anhydride, 98%
CAS: 336-59-4 | C8F14O3 | 410.06 g/mol
Supplier: Thermo Scientific Chemicals 169261000
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Acylation reagentSpecifications
| Heptafluorobutyric anhydride | |
| -43°C | |
| 108°C to 111°C | |
| 98+% | |
| C8F14O3 | |
| MFCD00000432 | |
| 1.65 | |
| Solubility in water: reacts with water forming heptafluorobutyric acid | |
| FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F | |
| 410.06 | |
| CHEBI:39424 | |
| 98+% |
| 336-59-4 | |
| 1.6500g/mL | |
| Authentic | |
| Glass bottle | |
| (CF3CF2CF2CO)2O | |
| 100 g | |
| heptafluorobutyric anhydride, perfluorobutyric anhydride, hfba, heptafluorobutanoic anhydride, 2,2,3,3,4,4,4-heptafluorobutanoic anhydride, butanoic acid, heptafluoro-, anhydride, heptafluoro-n-butyric anhydride, heptafluorobutyric acid anhydride, butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride, heptafluorobutyric anhydride, for gc derivatization | |
| UFFSXJKVKBQEHC-UHFFFAOYSA-N | |
| 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate | |
| 67643 | |
| 410.05 | |
| Liquid |
Chemical Identifiers
| 336-59-4 | |
| 410.06 | |
| UFFSXJKVKBQEHC-UHFFFAOYSA-N | |
| 67643 | |
| 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| C8F14O3 | |
| MFCD00000432 | |
| heptafluorobutyric anhydride, perfluorobutyric anhydride, hfba, heptafluorobutanoic anhydride, 2,2,3,3,4,4,4-heptafluorobutanoic anhydride, butanoic acid, heptafluoro-, anhydride, heptafluoro-n-butyric anhydride, heptafluorobutyric acid anhydride, butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride, heptafluorobutyric anhydride, for gc derivatization | |
| CHEBI:39424 | |
| FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
Safety and Handling
GHS H Statement
Causes severe skin burns and eye damage.
GHS P Statement
IF SWALLOWED: rinse mouth.
Do NOT induce vomiting.
Wear eye protection/face protection.
IF IN EYES: Rinse cautiously with water for several minutes.
Remove contact lenses,if present and easy to do.
Continue rinsi
GHS Signal Word: Danger
EINECSNumber : 206-410-8
RUO – Research Use Only