missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ Hemin Chloride, Calbiochem™,
Iron-containing compound of porcine origin that can induce hydrogen peroxide-dependent lipid peroxidation
Supplier: MilliporeSigma™ 37415GM
Specifications
| Hemin Chloride | |
| Purple | |
| MFCD00010726 | |
| chlorohemin, hemin chloride, protoferriheme, ferriheme, ferriprotoporphyrin ix chloride, ferriprotoporphyrin ix, panhematin, protohemin, protohemin ix, ferriprotoporphyrin | |
| CC1=C(CCC(O)=O)\C2=C\C3=C(CCC(O)=O)C(C)=C4\C=C5/N=C(/C=C6\N([Fe](Cl)N34)\C(=C/C1=N2)C(C=C)=C6C)C(C=C)=C5C | |
| 651.95 | |
| 652 |
| 16009-13-5 | |
| C34H32ClFeN4O4 | |
| 5 g | |
| BTIJJDXEELBZFS-HXFTUNQESA-K | |
| 3-[(1Z,6Z,12Z,17Z)-5-(2-carboxyethyl)-22-chloro-15,20-diethenyl-4,10,14,19-tetramethyl-21,23,24,25-tetraaza-22-ferrahexacyclo[9.9.3.1³,â¶.1¹³,¹â¶.0â¸,²³.0¹â¸,²¹]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaen-9-yl]propanoic acid | |
| 131675604 | |
| Solid |
Chemical Identifiers
| 16009-13-5 | |
| 651.95 | |
| BTIJJDXEELBZFS-HXFTUNQESA-K | |
| 131675604 | |
| CC1=C(CCC(O)=O)\C2=C\C3=C(CCC(O)=O)C(C)=C4\C=C5/N=C(/C=C6\N([Fe](Cl)N34)\C(=C/C1=N2)C(C=C)=C6C)C(C=C)=C5C |
| C34H32ClFeN4O4 | |
| MFCD00010726 | |
| chlorohemin, hemin chloride, protoferriheme, ferriheme, ferriprotoporphyrin ix chloride, ferriprotoporphyrin ix, panhematin, protohemin, protohemin ix, ferriprotoporphyrin | |
| 3-[(1Z,6Z,12Z,17Z)-5-(2-carboxyethyl)-22-chloro-15,20-diethenyl-4,10,14,19-tetramethyl-21,23,24,25-tetraaza-22-ferrahexacyclo[9.9.3.1³,â¶.1¹³,¹â¶.0â¸,²³.0¹â¸,²¹]pentacosa-1,3(25),4,6,8,10,12,14,16(24),17,19-undecaen-9-yl]propanoic acid |
Safety and Handling
Recommended Storage : 15° to 30°C (59° to 86°F); Keep container tightly closed. Keep container in a cool, well-ventilated area.