missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Guanosine-5'-Triphosphate Trisodium Salt 98-100%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0215121625
| Quantity | 25 mg |
|---|
Chemical Identifiers
| 36051-31-7 | |
| 547.49 | |
| NMQPZZLDIUETGE-GWTDSMLYSA-N | |
| 92044363 |
| C10H16MgN5O14P3 | |
| MFCD00077781,MFCD00077781 | |
| 5'-gtp trisodium salt, 5 acute-gtp trisodium salt | |
| [Mg].NC1=NC(=O)C2=C(N1)N(C=N2)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O |
Specifications
| Guanosine-5'-Triphosphate Trisodium Salt | |
| White | |
| C10H16MgN5O14P3 | |
| MFCD00077781,MFCD00077781 | |
| NMQPZZLDIUETGE-GWTDSMLYSA-N | |
| ({[({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy](hydroxy)phosphoryl}oxy)phosphonic acid magnesium | |
| 92044363 | |
| Powder |
| 36051-31-7 | |
| 98 to 100% | |
| 25 mg | |
| 5'-gtp trisodium salt, 5 acute-gtp trisodium salt | |
| [Mg].NC1=NC(=O)C2=C(N1)N(C=N2)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O | |
| 547.49 | |
| 588.2 (Anhydrous) |
Safety and Handling
Recommended Storage : Store at -0 °C.