Learn More
Guaiazulene, 99%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 120200100
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Guaiazulene | |
| 0.9700g/mL | |
| >110°C | |
| 98.5% min. (GC) | |
| C15H18 | |
| 05,II,473 | |
| 15,459 | |
| Solubility in water: 25%. Other solubilities: soluble in ethanol, ethyl ether and ethyl acetate | |
| CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C | |
| 198.31 | |
| CHEBI:5550 | |
| 99% |
| 489-84-9 | |
| 153.0°C (7.0 Torr) | |
| Authentic | |
| Glass bottle | |
| 10g | |
| 0.97 | |
| guaiazulene, 1,4-dimethyl-7-isopropylazulene, azulon, vetivazulen, azunol, 7-isopropyl-1,4-dimethylazulene, eucazulen, guajazulene, kessazulen, purazulen | |
| FWKQNCXZGNBPFD-UHFFFAOYSA-N | |
| 1,4-dimethyl-7-propan-2-ylazulene | |
| 3515 | |
| 198.31 |
Chemical Identifiers
| 489-84-9 | |
| 198.31 | |
| guaiazulene, 1,4-dimethyl-7-isopropylazulene, azulon, vetivazulen, azunol, 7-isopropyl-1,4-dimethylazulene, eucazulen, guajazulene, kessazulen, purazulen | |
| CHEBI:5550 | |
| CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C |
| C15H18 | |
| FWKQNCXZGNBPFD-UHFFFAOYSA-N | |
| 3515 | |
| 1,4-dimethyl-7-propan-2-ylazulene |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 207-701-2
RUO â Research Use Only