missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Guaiazulene, 99%
CAS: 489-84-9 | C15H18 | 198.31 g/mol
Supplier: Thermo Scientific Chemicals 120200250
| Quantity | 25 g |
|---|---|
| Packaging | Glass bottle |
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 489-84-9 | |
| 198.31 | |
| guaiazulene, 1,4-dimethyl-7-isopropylazulene, azulon, vetivazulen, azunol, 7-isopropyl-1,4-dimethylazulene, eucazulen, guajazulene, kessazulen, purazulen | |
| CHEBI:5550 | |
| CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C |
| C15H18 | |
| FWKQNCXZGNBPFD-UHFFFAOYSA-N | |
| 3515 | |
| 1,4-dimethyl-7-propan-2-ylazulene |
Specifications
| Guaiazulene | |
| 29.0°C to 31.0°C | |
| 0.9700g/mL | |
| >110°C | |
| 98.5% min. (GC) | |
| C15H18 | |
| 05,II,473 | |
| 15,459 | |
| Solubility in water: 25%. Other solubilities: soluble in ethanol, ethyl ether and ethyl acetate | |
| CC1=C2C=CC(=C2C=C(C=C1)C(C)C)C | |
| 198.31 | |
| CHEBI:5550 | |
| 99% |
| 489-84-9 | |
| Blue | |
| 153.0°C (7.0 Torr) | |
| Authentic | |
| Glass bottle | |
| 25 g | |
| 0.97 | |
| guaiazulene, 1,4-dimethyl-7-isopropylazulene, azulon, vetivazulen, azunol, 7-isopropyl-1,4-dimethylazulene, eucazulen, guajazulene, kessazulen, purazulen | |
| FWKQNCXZGNBPFD-UHFFFAOYSA-N | |
| 1,4-dimethyl-7-propan-2-ylazulene | |
| 3515 | |
| 198.31 | |
| Low Melting Crystalline Solid |
Safety and Handling
GHS H Statement
Harmful if swallowed.
GHS P Statement
IF SWALLOWED: Call a POISON CENTER or doctor/physician if you feel unwell.
GHS Signal Word: Warning
EINECSNumber : 207-701-2