missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Glutathione Reduced Crystalline MP Biomedicals
Supplier: MP Biomedicals Inc 0210181450
Specifications
| Glutathione | |
| 70-18-8 | |
| >98% | |
| MFCD00065939 | |
| glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
| 307.321 | |
| CHEBI:16856 | |
| Powder |
| Reduced | |
| White | |
| C10H17N3O6S | |
| 50 g | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
| 124886 | |
| 307.3 |
Chemical Identifiers
| 70-18-8 | |
| 307.321 | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| 124886 | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| C10H17N3O6S | |
| MFCD00065939 | |
| glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
| CHEBI:16856 | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
Safety and Handling
EINECSNumber : 200-725-4
Recommended Storage : Store at 4°C. Store under nitrogen.