missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Glutathione, 98%, for analysis, reduced
CAS: 70-18-8 | C10H17N3O6S | 307.32 g/mol
Supplier: Thermo Scientific Chemicals 120000010
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Glutathione | |
| 70-18-8 | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00065939 | |
| 04,II,931 | |
| − 16.50 (20.00°C c=2,H2O) | |
| glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid | |
| 124886 | |
| 307.32 | |
| Analysis |
| For analysis, Reduced | |
| 182.0°C to 192.0°C | |
| 0.5% max. (105°C, 3 hrs) | |
| 97.5% min. (Iodimetry) | |
| C10H17N3O6S | |
| 1 g | |
| 15,4511 | |
| − 16.50 | |
| Solubility in water: very soluble. Other solubilities: freely soluble in dilute alcohol and dimethyl-, formamide, almost insoluble in ethanol | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N | |
| 307.32 | |
| CHEBI:16856 | |
| 98% | |
| Crystalline Powder |
Chemical Identifiers
| 70-18-8 | |
| 307.32 | |
| RWSXRVCMGQZWBV-WDSKDSINSA-N | |
| 124886 | |
| (2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| C10H17N3O6S | |
| MFCD00065939 | |
| glutathione, l-glutathione, glutathion, glutathione-sh, glutinal, isethion, tathion, reduced glutathione, deltathione, neuthion | |
| CHEBI:16856 | |
| C(CC(=O)NC(CS)C(=O)NCC(=O)O)C(C(=O)O)N |
Safety and Handling
EINECSNumber : 200-725-4
RUO – Research Use Only