missing translation for 'onlineSavingsMsg'
Learn More
Learn More
gamma-Benzyl L-glutamate, 99%
CAS: 1676-73-9 | C12H15NO4 | 237.25 g/mol
Supplier: Thermo Scientific Chemicals 225670050
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| γ-Benzyl L-glutamate | |
| 1676-73-9 | |
| White | |
| 98.5% min. (HPLC) | |
| C12H15NO4 | |
| MFCD00002633 | |
| + 27.2 | |
| BGGHCRNCRWQABU-JTQLQIEISA-N | |
| (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid | |
| 122337 | |
| 99% |
| 99+% | |
| 162°C to 167°C | |
| Authentic | |
| Glass bottle | |
| C6H5CH2O2CCH2CH2CH(NH2)CO2H | |
| 5 g | |
| h-glu obzl-oh, gamma-benzyl l-glutamate, l-glutamic acid 5-benzyl ester, 5-benzyl l-glutamate, l-glutamic acid gamma-benzyl ester, s-2-amino-5-benzyloxy-5-oxopentanoic acid, 2s-2-amino-5-benzyloxy-5-oxopentanoic acid, glutamic acid, 5-benzyl ester, l, gama-benzyl l-glutamate, h-glu obzl-oh.hcl | |
| C1=CC=C(C=C1)COC(=O)CCC(C(=O)O)N | |
| 237.25 | |
| 237.25 | |
| Powder |
Chemical Identifiers
| 1676-73-9 | |
| 237.25 | |
| BGGHCRNCRWQABU-JTQLQIEISA-N | |
| 122337 | |
| C1=CC=C(C=C1)COC(=O)CCC(C(=O)O)N |
| C12H15NO4 | |
| MFCD00002633 | |
| h-glu obzl-oh, gamma-benzyl l-glutamate, l-glutamic acid 5-benzyl ester, 5-benzyl l-glutamate, l-glutamic acid gamma-benzyl ester, s-2-amino-5-benzyloxy-5-oxopentanoic acid, 2s-2-amino-5-benzyloxy-5-oxopentanoic acid, glutamic acid, 5-benzyl ester, l, gama-benzyl l-glutamate, h-glu obzl-oh.hcl | |
| (2S)-2-amino-5-oxo-5-phenylmethoxypentanoic acid |
Safety and Handling
EINECSNumber : 216-826-1
TSCA : TSCA
RUO – Research Use Only