missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Folic acid, ≥95%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0210172505
Specifications
| Folic acid | |
| Yellow to Orange | |
| C19H19N7O6 | |
| folic acid, folate, pteroylglutamic acid, vitamin m, folacin, folacid, pteglu, vitamin b9, folvite, pteroyl-l-glutamic acid | |
| C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)N=C(N3)N | |
| 441.404 | |
| CHEBI:27470 | |
| Powder |
| 59-30-3 | |
| ≥95% | |
| 5 g | |
| OVBPIULPVIDEAO-LBPRGKRZSA-N | |
| (2S)-2-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid | |
| 6037 | |
| 441.4 |
Chemical Identifiers
| 59-30-3 | |
| 441.404 | |
| folic acid, folate, pteroylglutamic acid, vitamin m, folacin, folacid, pteglu, vitamin b9, folvite, pteroyl-l-glutamic acid | |
| CHEBI:27470 | |
| C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=O)N=C(N3)N |
| C19H19N7O6 | |
| OVBPIULPVIDEAO-LBPRGKRZSA-N | |
| 6037 | |
| (2S)-2-[[4-[(2-amino-4-oxo-1H-pteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |