Learn More
Fluorometholone, 97%, Thermo Scientific™
Fluorometholone, CAS # 426-13-1, is a glucocorticoid with anti-inflammatory properties.
Supplier: Thermo Scientific Chemicals 460200010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Fluorometholone | |
| 1% max. | |
| 96% min. (HPLC) | |
| C22H29FO4 | |
| fluorometholone, oxylone, flumetholon, fluormetholone, fml liquifilm, fluor-op, cortilet, delmeson, trilcin, fml forte | |
| FAOZLTXFLGPHNG-KNAQIMQKSA-N | |
| (6S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one | |
| 9878 | |
| 376.46 |
| 426-13-1 | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| (2.5% in pyridine) clear colorless to light yellow | |
| CC1CC2C3CCC(C3(CC(C2(C4(C1=CC(=O)C=C4)C)F)O)C)(C(=O)C)O | |
| 376.46 | |
| CHEBI:31625 | |
| 97% |
Chemical Identifiers
| 426-13-1 | |
| 376.46 | |
| fluorometholone, oxylone, flumetholon, fluormetholone, fml liquifilm, fluor-op, cortilet, delmeson, trilcin, fml forte | |
| CHEBI:31625 | |
| CC1CC2C3CCC(C3(CC(C2(C4(C1=CC(=O)C=C4)C)F)O)C)(C(=O)C)O |
| C22H29FO4 | |
| FAOZLTXFLGPHNG-KNAQIMQKSA-N | |
| 9878 | |
| (6S,8S,9R,10S,11S,13S,14S,17R)-17-acetyl-9-fluoro-11,17-dihydroxy-6,10,13-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
Safety and Handling
GHS H Statement
Harmful if swallowed.
Harmful in contact with skin.
Harmful if inhaled.
GHS P Statement
Wear protective gloves/protective clothing.
IF ON SKIN: Wash with plenty of soap and water.
Call a POISON CENTER or doctor/physician if you feel unwell.
IF INHALED: Remove to fresh air and keep at rest in a position
GHS Signal Word: Warning
EINECSNumber : 207-041-5
RUO â Research Use Only