Learn More
Thermo Scientific Chemicals Fluorescein
CAS: 2321-07-5 | C20H12O5 | 332.31 g/mol
$82.44 - $347.77
Chemical Identifiers
| CAS | 2321-07-5 |
|---|---|
| Molecular Formula | C20H12O5 |
| Molecular Weight (g/mol) | 332.31 |
| MDL Number | MFCD00005050 |
| InChI Key | GNBHRKFJIUUOQI-UHFFFAOYSA-N |
| Synonym | fluorescein, solvent yellow 94, resorcinolphthalein, yellow fluorescein, 3,6-fluorandiol, d and c yellow no. 7, fluoresceine, japan yellow 201, c.i. solvent yellow 94, d&c yellow no. 7 |
| PubChem CID | 16850 |
| ChEBI | CHEBI:31624 |
| IUPAC Name | 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Price | Quantity | |||||
|
AAL1325122
|
Thermo Scientific Chemicals
L1325122 |
100 g |
Each for $82.44
|
|
|||||
|
AAL1325136
|
Thermo Scientific Chemicals
L1325136 |
500 g |
Each for $347.77
|
|
|||||
Description
Fluorescein is used as a fluorescent tracer for many applications including in a type of dye laser as the gain medium, in forensics and serology to detect latent blood stains and in dye tracing. It is used to localise multiple muscular ventricular septal defects during open heart surgery and confirm the presence of any residual defects. It is applied to teeth to reveal plaque.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
SolubilitySlightly soluble in water and alcohol.
Notes
Incompatibles with strong oxidizing agents. Moisture sensitive.
Chemical Identifiers
| 2321-07-5 | |
| 332.31 | |
| GNBHRKFJIUUOQI-UHFFFAOYSA-N | |
| 16850 | |
| 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| C20H12O5 | |
| MFCD00005050 | |
| fluorescein, solvent yellow 94, resorcinolphthalein, yellow fluorescein, 3,6-fluorandiol, d and c yellow no. 7, fluoresceine, japan yellow 201, c.i. solvent yellow 94, d&c yellow no. 7 | |
| CHEBI:31624 | |
| C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
Specifications
| 2321-07-5 | |
| C20H12O5 | |
| 100 g | |
| 14,4159 | |
| Slightly soluble in water and alcohol. | |
| C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O | |
| 332.31 | |
| CHEBI:31624 | |
| ≥90% |
| 320°C | |
| MFCD00005050 | |
| 94324 | |
| fluorescein, solvent yellow 94, resorcinolphthalein, yellow fluorescein, 3,6-fluorandiol, d and c yellow no. 7, fluoresceine, japan yellow 201, c.i. solvent yellow 94, d&c yellow no. 7 | |
| GNBHRKFJIUUOQI-UHFFFAOYSA-N | |
| 3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one | |
| 16850 | |
| 332.32 | |
| Fluorescein |
Safety and Handling
GHS H Statement
H319
Causes serious eye irritation.
P264b-P280i-P305+P351+P338
H319
EINECSNumber : 219-031-8
RTECSNumber : LM5075000
TSCA : Yes
Recommended Storage : Ambient temperatures
RUO – Research Use Only