missing translation for 'onlineSavingsMsg'
Learn More
Learn More
FD and C Yellow No. 6, Spectrum™ Chemical
FD155, 2783-94-0, C16H10N2O7S2Na2
Supplier: Spectrum Chemical Mfg Cor FD155100GM
Description
Spectrum™ Chemical FD and C Yellow No. 6Specifications
| FD and C Yellow No. 6 | |
| 100% | |
| TXVRKNUZLYFDTJ-DDVLFWKVSA-L | |
| disodium (5E)-6-oxo-5-[2-(4-sulfonatophenyl)hydrazin-1-ylidene]-5,6-dihydronaphthalene-2-sulfonate | |
| 87% | |
| Poly Pail | |
| 100 g |
| 2783-94-0 | |
| C16H10N2Na2O7S2 | |
| [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C(N\N=C2\C(=O)C=CC3=CC(=CC=C23)S([O-])(=O)=O)C=C1 | |
| 452.36 | |
| Reagent | |
| Orange to Yellow |
Chemical Identifiers
| 2783-94-0 | |
| 452.36 | |
| disodium (5E)-6-oxo-5-[2-(4-sulfonatophenyl)hydrazin-1-ylidene]-5,6-dihydronaphthalene-2-sulfonate |
| C16H10N2Na2O7S2 | |
| TXVRKNUZLYFDTJ-DDVLFWKVSA-L | |
| [Na+].[Na+].[O-]S(=O)(=O)C1=CC=C(N\N=C2\C(=O)C=CC3=CC(=CC=C23)S([O-])(=O)=O)C=C1 |