missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Farnesyl acetate, mixture of isomers, 96%
CAS: 29548-30-9 | C17H28O2 | 264.409 g/mol
Supplier: Thermo Scientific Chemicals A1977822
| Quantity | 100 g |
|---|
Description
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 29548-30-9 | |
| 264.409 | |
| ZGIGZINMAOQWLX-NCZFFCEISA-N | |
| 638500 | |
| CC(=CCCC(=CCCC(=CCOC(=O)C)C)C)C |
| C17H28O2 | |
| MFCD00036516 | |
| farnesyl acetate, farnesol acetate, all-trans-farnesyl acetate, unii-d5zj1foc2i, trans,trans-farnesyl acetate, d5zj1foc2i, 3,7,11-trimethyl-2,6,10-dodecatrienyl acetate, 2e,6e-farnesyl acetate, 2,6,10-dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, e,e, 2e,6e-3,7,11-trimethyldodeca-2,6,10-trien-1-yl acetate | |
| [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate |
Specifications
| Farnesyl acetate | |
| 29548-30-9 | |
| 95°C (203°F) | |
| 1.477 | |
| MFCD00036516 | |
| farnesyl acetate, farnesol acetate, all-trans-farnesyl acetate, unii-d5zj1foc2i, trans,trans-farnesyl acetate, d5zj1foc2i, 3,7,11-trimethyl-2,6,10-dodecatrienyl acetate, 2e,6e-farnesyl acetate, 2,6,10-dodecatrien-1-ol, 3,7,11-trimethyl-, acetate, e,e, 2e,6e-3,7,11-trimethyldodeca-2,6,10-trien-1-yl acetate | |
| CC(=CCCC(=CCCC(=CCOC(=O)C)C)C)C | |
| 264.409 | |
| 264.41 |
| mixture of isomers | |
| 0.91 | |
| C17H28O2 | |
| 100 g | |
| 1784823 | |
| ZGIGZINMAOQWLX-NCZFFCEISA-N | |
| [(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl] acetate | |
| 638500 | |
| 96% |
Safety and Handling
EINECSNumber : 249-689-1
TSCA : Yes
Recommended Storage : Ambient temperatures