missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethynylestradiol 98.0+%, TCI America™
Supplier: TCI America E00371G
Specifications
| Ethynylestradiol | |
| 182°C | |
| MFCD00003690 | |
| ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin | |
| C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C | |
| 296.41 | |
| CHEBI:4903 | |
| ≥98.0% (HPLC,T) |
| 57-63-6 | |
| C20H24O2 | |
| 1 g | |
| BFPYWIDHMRZLRN-SLHNCBLASA-N | |
| (1R,3aS,3bR,9bS,11aS)-1-ethynyl-11a-methyl-1H,2H,3H,3aH,3bH,4H,5H,9bH,10H,11H,11aH-cyclopenta[a]phenanthrene-1,7-diol | |
| 5991 | |
| 296.41 | |
| Crystalline Powder |
Chemical Identifiers
| 57-63-6 | |
| 296.41 | |
| BFPYWIDHMRZLRN-SLHNCBLASA-N | |
| 5991 | |
| (1R,3aS,3bR,9bS,11aS)-1-ethynyl-11a-methyl-1H,2H,3H,3aH,3bH,4H,5H,9bH,10H,11H,11aH-cyclopenta[a]phenanthrene-1,7-diol |
| C20H24O2 | |
| MFCD00003690 | |
| ethinyl estradiol, ethynylestradiol, ethynyl estradiol, ethinylestradiol, ethinyloestradiol, ginestrene, 17-ethinylestradiol, progynon c, ethinoral, eticyclin | |
| CHEBI:4903 | |
| C[C@]12CC[C@H]3[C@@H](CCC4=CC(O)=CC=C34)[C@@H]1CC[C@@]2(O)C#C |
Safety and Handling
RTECSNumber : RC8925000
TSCA : Yes