missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethylene Glycol-bis-(β-Aminoethylether)-N,N,N',N'- tetraacetic acid, Molecular Biology Reagent Grade, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219482380
Specifications
| Ethylene Glycol-bis-(β-Aminoethylether)-N,N,N',N'- tetraacetic acid | |
| White | |
| MFCD00004291 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 380.35 | |
| CHEBI:30740 | |
| Molecular Biology Reagent |
| 67-42-5 | |
| C14H24N2O10 | |
| 100 g | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | |
| 6207 | |
| 380.4 | |
| Powder |
Chemical Identifiers
| 67-42-5 | |
| 380.35 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 6207 | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| C14H24N2O10 | |
| MFCD00004291 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| CHEBI:30740 | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Safety and Handling
EINECSNumber : 200-651-2