missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethylene glycol-bis-(β-aminoethylether)-N,N,N',N'-tetraacetic acid, 99.6%, MP Biomedicals™
Supplier: MP Biomedicals Inc 0219517425
Specifications
| Ethylene glycol-bis-(β-aminoethylether)-N,N,N',N'-tetraacetic acid | |
| White | |
| 25 g | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | |
| 6207 | |
| 380.4 | |
| Powder |
| 67-42-5 | |
| C14H24N2O10 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 380.35 | |
| CHEBI:30740 | |
| 0.996 |
Chemical Identifiers
| 67-42-5 | |
| 380.35 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| CHEBI:30740 | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| C14H24N2O10 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 6207 | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |