missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethylene Glycol-Bis(2-Aminoethylether)-N,N,N',N'-Tetraacetic Acid, Honeywell Fluka™
for complexometry,≥98.0% (T)
Supplier: Honeywell-Fluka 0377950G
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Specifications
| Ethylene Glycol-Bis(2-Aminoethylether)-N,N,N′,N′-Tetraacetic Acid | |
| 50 g | |
| C14H24N2O10 | |
| MFCD00004291 | |
| 1717370 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | |
| 6207 | |
| 380.35g/mol |
| 67-42-5 | |
| Glass Bottle | |
| [-CH2OCH2CH2N(CH2CO2H)2]2 | |
| NONH for all modes of transport | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 380.35 | |
| CHEBI:30740 | |
| ≥98% (T) |
Chemical Identifiers
| 67-42-5 | |
| 380.35 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 6207 | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| C14H24N2O10 | |
| MFCD00004291 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| CHEBI:30740 | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Safety and Handling
EINECSNumber : 200-651-2
RTECSNumber : AH3760000