missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl Violet, 80%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 410490250
Specifications
| Ethyl Violet | |
| 75% min. | |
| MFCD00011765 | |
| Solubility in water: slightly soluble. Other solubilities: soluble in methanol and ethanol | |
| Authentic | |
| [4-[bis[4-(diethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;chloride | |
| 16955 | |
| 4% max. | |
| 80% | |
| 25 g |
| 2390-59-2 | |
| C31H42ClN3 | |
| Basic Violet 4, C.I. 42600 | |
| JVICFMRAVNKDOE-UHFFFAOYSA-M | |
| [Cl-].CCN(CC)C1=CC=C(C=C1)[C+](C1=CC=C(C=C1)N(CC)CC)C1=CC=C(C=C1)N(CC)CC | |
| 492.15 | |
| 593 to 599nm (c=0.1, H2O) | |
| 492.14 | |
| Glass bottle |
Chemical Identifiers
| 2390-59-2 | |
| 492.15 | |
| JVICFMRAVNKDOE-UHFFFAOYSA-M | |
| 16955 | |
| [Cl-].CCN(CC)C1=CC=C(C=C1)[C+](C1=CC=C(C=C1)N(CC)CC)C1=CC=C(C=C1)N(CC)CC |
| C31H42ClN3 | |
| MFCD00011765 | |
| Basic Violet 4, C.I. 42600 | |
| [4-[bis[4-(diethylamino)phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-diethylazanium;chloride |
RUO – Research Use Only