missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl chrysanthemate, 95%, mixture of cis and trans
CAS: 97-41-6 | C12H20O2 | 196.29 g/mol
$76.65 - $76.65
Chemical Identifiers
| CAS | 97-41-6 |
|---|---|
| Molecular Formula | C12H20O2 |
| Molecular Weight (g/mol) | 196.29 |
| MDL Number | MFCD00001304 |
| InChI Key | VIMXTGUGWLAOFZ-UHFFFAOYSA-N |
| Synonym | ethyl chrysanthemate, ethyl chrysanthemumate, chrysanthemic acid ethyl ester, cyclopropanecarboxylic acid, 2,2-dimethyl-3-2-methyl-1-propenyl-, ethyl ester, ethylchrysanthemate, ccris 2498, chrysanthemic acid, ethyl ester, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methylprop-1-en-1-yl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropane-1-carboxylate |
| PubChem CID | 7334 |
| IUPAC Name | ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1C(C1(C)C)C=C(C)C |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC156060250
|
Thermo Scientific Chemicals
156060250 |
25 g | Glass bottle |
Each for $76.65
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 97-41-6 | |
| 196.29 | |
| VIMXTGUGWLAOFZ-UHFFFAOYSA-N | |
| 7334 | |
| CCOC(=O)C1C(C1(C)C)C=C(C)C |
| C12H20O2 | |
| MFCD00001304 | |
| ethyl chrysanthemate, ethyl chrysanthemumate, chrysanthemic acid ethyl ester, cyclopropanecarboxylic acid, 2,2-dimethyl-3-2-methyl-1-propenyl-, ethyl ester, ethylchrysanthemate, ccris 2498, chrysanthemic acid, ethyl ester, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methylprop-1-en-1-yl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropane-1-carboxylate | |
| ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate |
Specifications
| 97-41-6 | |
| 0.9000g/mL | |
| 84°C | |
| 94% min. (GC) | |
| C12H20O2 | |
| MFCD00001304 | |
| 09, II, 45 | |
| ethyl chrysanthemate, ethyl chrysanthemumate, chrysanthemic acid ethyl ester, cyclopropanecarboxylic acid, 2,2-dimethyl-3-2-methyl-1-propenyl-, ethyl ester, ethylchrysanthemate, ccris 2498, chrysanthemic acid, ethyl ester, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methylprop-1-en-1-yl cyclopropanecarboxylate, ethyl 2,2-dimethyl-3-2-methyl-1-propenyl cyclopropane-1-carboxylate | |
| CCOC(=O)C1C(C1(C)C)C=C(C)C | |
| 196.29 | |
| 196.29 | |
| Liquid |
| Colorless to Yellow | |
| 112°C (10.0 mmHg) | |
| Authentic | |
| Glass bottle | |
| 1.4590 to 1.461 | |
| 25 g | |
| 0.9 | |
| VIMXTGUGWLAOFZ-UHFFFAOYSA-N | |
| ethyl 2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate | |
| 7334 | |
| 95% | |
| Ethyl chrysanthemate, 95% |
Safety and Handling
EINECSNumber : 202-579-7
RTECSNumber : GZ1727000
TSCA : TSCA
RUO – Research Use Only