missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl benzoylacetate, 90%
CAS: 94-02-0 | C11H12O3 | 192.21 g/mol
$113.45 - $113.45
Chemical Identifiers
| CAS | 94-02-0 |
|---|---|
| Molecular Formula | C11H12O3 |
| Molecular Weight (g/mol) | 192.21 |
| MDL Number | MFCD00009196 |
| InChI Key | GKKZMYDNDDMXSE-UHFFFAOYSA-N |
| Synonym | ethyl benzoylacetate, benzoylacetic acid ethyl ester, ethyl benzoyl acetate, acetic acid, benzoyl-, ethyl ester, ethyl beta-oxobenzenepropanoate, ethylbenzoylacetate, benzoylacetic acid, ethyl ester, ethyl 3-phenyl-3-oxopropanoate, benzenepropanoic acid, beta-oxo-, ethyl ester, ethyl 3-oxo-3-phenylpropionate |
| PubChem CID | 7170 |
| IUPAC Name | ethyl 3-oxo-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(=O)C1=CC=CC=C1 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC370851000
|
Thermo Scientific Chemicals
370851000 |
100 g | Glass bottle |
Each for $113.45
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 94-02-0 | |
| 192.21 | |
| GKKZMYDNDDMXSE-UHFFFAOYSA-N | |
| 7170 | |
| CCOC(=O)CC(=O)C1=CC=CC=C1 |
| C11H12O3 | |
| MFCD00009196 | |
| ethyl benzoylacetate, benzoylacetic acid ethyl ester, ethyl benzoyl acetate, acetic acid, benzoyl-, ethyl ester, ethyl beta-oxobenzenepropanoate, ethylbenzoylacetate, benzoylacetic acid, ethyl ester, ethyl 3-phenyl-3-oxopropanoate, benzenepropanoic acid, beta-oxo-, ethyl ester, ethyl 3-oxo-3-phenylpropionate | |
| ethyl 3-oxo-3-phenylpropanoate |
Specifications
| 94-02-0 | |
| 1.1060g/mL | |
| 140°C | |
| 88% min. (HPLC) | |
| C11H12O3 | |
| MFCD00009196 | |
| 10, 674 | |
| 15, 3822 | |
| Solubility in water: insoluble. Other solubilities: soluble in alcohols,ethers,miscible with oils | |
| CCOC(=O)CC(=O)C1=CC=CC=C1 | |
| 192.21 | |
| 192.21 | |
| Powder |
| Brown | |
| 265°C to 270°C | |
| Authentic | |
| Glass bottle | |
| 1.5240 to 1.531 | |
| 100 g | |
| 1.106 | |
| ethyl benzoylacetate, benzoylacetic acid ethyl ester, ethyl benzoyl acetate, acetic acid, benzoyl-, ethyl ester, ethyl beta-oxobenzenepropanoate, ethylbenzoylacetate, benzoylacetic acid, ethyl ester, ethyl 3-phenyl-3-oxopropanoate, benzenepropanoic acid, beta-oxo-, ethyl ester, ethyl 3-oxo-3-phenylpropionate | |
| GKKZMYDNDDMXSE-UHFFFAOYSA-N | |
| ethyl 3-oxo-3-phenylpropanoate | |
| 7170 | |
| 90% | |
| Ethyl benzoylacetate |
Safety and Handling
EINECSNumber : 202-295-3
RUO – Research Use Only