missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Please login to your online account to display your discounted pricing
Ethyl 4-Nitrocinnamate 98.0+%, TCI America™
Supplier: TCI America N05985G
Specifications
| Ethyl 4-Nitrocinnamate | |
| 138°C | |
| MFCD00007380 | |
| ethyl 4-nitrocinnamate, ethyl p-nitrocinnamate, ethyl 3-4-nitrophenyl acrylate, 2-propenoic acid, 3-4-nitrophenyl-, ethyl ester, cinnamic acid, p-nitro-, ethyl ester, ethyl-4-nitrocinnamate, e-ethyl 3-4-nitrophenyl acrylate, propenoic acid, 3-4-nitrophenyl-, ethyl ester, 4-nitrozimtsaeure-ethylester, ethyl 2e-3-4-nitrophenyl prop-2-enoate | |
| CCOC(=O)C=CC1=CC=C(C=C1)[N+](=O)[O-] | |
| 221.212 | |
| 221.21 | |
| Crystalline Powder |
| 953-26-4 | |
| C11H11NO4 | |
| 5 g | |
| PFBQVGXIMLXCQB-VMPITWQZSA-N | |
| ethyl (E)-3-(4-nitrophenyl)prop-2-enoate | |
| 1268038 | |
| ≥98.0% (GC) |
Chemical Identifiers
| 953-26-4 | |
| 221.212 | |
| PFBQVGXIMLXCQB-VMPITWQZSA-N | |
| 1268038 | |
| CCOC(=O)C=CC1=CC=C(C=C1)[N+](=O)[O-] |
| C11H11NO4 | |
| MFCD00007380 | |
| ethyl 4-nitrocinnamate, ethyl p-nitrocinnamate, ethyl 3-4-nitrophenyl acrylate, 2-propenoic acid, 3-4-nitrophenyl-, ethyl ester, cinnamic acid, p-nitro-, ethyl ester, ethyl-4-nitrocinnamate, e-ethyl 3-4-nitrophenyl acrylate, propenoic acid, 3-4-nitrophenyl-, ethyl ester, 4-nitrozimtsaeure-ethylester, ethyl 2e-3-4-nitrophenyl prop-2-enoate | |
| ethyl (E)-3-(4-nitrophenyl)prop-2-enoate |
Safety and Handling
RTECSNumber : GE0353332
TSCA : Yes