missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethyl 3-Methyl-3-phenylglycidate (mixture of isomers) 95.0+%, TCI America™
Supplier: TCI America E0873250G
Specifications
| Ethyl 3-Methyl-3-phenylglycidate (mixture of isomers) | |
| Yellow | |
| C12H14O3 | |
| 250 g | |
| LQKRYVGRPXFFAV-UHFFFAOYSA-N | |
| ethyl 3-methyl-3-phenyloxirane-2-carboxylate | |
| 6501 | |
| ≥95.0% (GC) |
| 77-83-8 | |
| 86°C | |
| MFCD00022338 | |
| ethyl methylphenylglycidate, ethyl 3-methyl-3-phenylglycidate, strawberry aldehyde, fraeseol, empg, c-16 aldehyde, aldehyde c-16, ethyl methylphenyl glycidate, ethyl-3-methyl-3-phenylglycidate, ethyl 2,3-epoxy-3-phenylbutyrate | |
| CCOC(=O)C1C(O1)(C)C2=CC=CC=C2 | |
| 206.241 | |
| 206.24 | |
| Liquid |
Chemical Identifiers
| 77-83-8 | |
| 206.241 | |
| LQKRYVGRPXFFAV-UHFFFAOYSA-N | |
| 6501 | |
| CCOC(=O)C1C(O1)(C)C2=CC=CC=C2 |
| C12H14O3 | |
| MFCD00022338 | |
| ethyl methylphenylglycidate, ethyl 3-methyl-3-phenylglycidate, strawberry aldehyde, fraeseol, empg, c-16 aldehyde, aldehyde c-16, ethyl methylphenyl glycidate, ethyl-3-methyl-3-phenylglycidate, ethyl 2,3-epoxy-3-phenylbutyrate | |
| ethyl 3-methyl-3-phenyloxirane-2-carboxylate |
Safety and Handling
EINECSNumber : (3)-3096
RTECSNumber : MW5250000
TSCA : Yes