missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethidium Bromide, Fisher BioReagents
$195.18 - $195.18
Chemical Identifiers
| CAS | 1239-45-8 |
|---|---|
| Molecular Formula | C21H20BrN3 |
| Molecular Weight (g/mol) | 394.32 |
| MDL Number | MFCD00011724 |
| InChI Key | ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| Synonym | ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l |
| PubChem CID | 14710 |
| ChEBI | CHEBI:4883 |
| IUPAC Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| SMILES | [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
Description
Used for fluorometric detection of double stranded nucleic acids. Also acts as an RNA polymerase inhibitor, and in separation of high molecular weight DNAs.Chemical Identifiers
| 1239-45-8 | |
| 394.32 | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 14710 | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| C21H20BrN3 | |
| MFCD00011724 | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| CHEBI:4883 | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
Specifications
| 1239-45-8 | |
| Purple | |
| 5% max. | |
| C21H20BrN3 | |
| 1 g | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 | |
| 394.32 | |
| CHEBI:4883 | |
| Powder or Solid |
| 260°C | |
| 4.0 to 7.0 | |
| Amber Glass | |
| MFCD00011724 | |
| 15, 4769 | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide | |
| 14710 | |
| 394.32 | |
| Ethidium Bromide |
Safety and Handling
DOTInformation : DOT Class 6.1, : Poison
TSCA : Not on TSCA inventory: for R and D use only; not for manufacturing or commercial purposes.
Recommended Storage : RT