missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethidium bromide, 95%, pure
CAS: 1239-45-8 | C21H20BrN3 | 394.32 g/mol
$65.34 - $227.36
Chemical Identifiers
| CAS | 1239-45-8 |
|---|---|
| Molecular Formula | C21H20BrN3 |
| Molecular Weight (g/mol) | 394.32 |
| MDL Number | MFCD00011724 |
| InChI Key | ZMMJGEGLRURXTF-UHFFFAOYSA-N |
| Synonym | ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l |
| PubChem CID | 14710 |
| ChEBI | CHEBI:4883 |
| IUPAC Name | 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| SMILES | [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC170960010
|
Thermo Scientific Chemicals
170960010 |
1 g | Glass bottle |
Each for $65.34
|
|
||||
|
AC170960050
|
Thermo Scientific Chemicals
170960050 |
5 g | Glass bottle |
Each for $227.36
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 1239-45-8 | |
| 394.32 | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 14710 | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide |
| C21H20BrN3 | |
| MFCD00011724 | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| CHEBI:4883 | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 |
Specifications
| 1239-45-8 | |
| Purple to Red | |
| >100°C | |
| Authentic | |
| Glass bottle | |
| MFCD00011724 | |
| 15,4769 | |
| (1% in water) Clear red | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 | |
| 394.32 | |
| CHEBI:4883 | |
| 95% | |
| Crystalline Powder |
| 260.0°C to 262.0°C | |
| ∼4.5 (1% aq. soln. at 20°C) | |
| 5.0% max. | |
| 94% min. (Argentometry) | |
| C21H20BrN3 | |
| 1 g | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide | |
| 14710 | |
| 394.3 | |
| Pure | |
| Ethidium bromide |
Safety and Handling
GHS H Statement
Suspected of causing genetic defects.
Fatal if inhaled.
Harmful if swallowed.
GHS P Statement
Immediately call a POISON CENTER or doctor/physician.
Use personal protective equipment as required.
IF INHALED: Remove victim to fresh air and keep at rest in a position comfortable for breathing.
GHS Signal Word: Danger
EINECSNumber : 214-984-6
RUO – Research Use Only