missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Ethidium Bromide (1% Solution/Molecular Biology), Fisher BioReagents
CAS: 1239-45-8 | C21H20BrN3 | 394.32 g/mol
Supplier: Fisher BioReagents V34702
Description
Amber Poly Bottle; 10mL
Ethidium Bromide is an intercalating dye used in the visualization of DNA and RNA in electrophoresis gels and cesium chloride density gradients.Greener Choice Claims
- Environmental benefits include:
- Recycled Content
- Non-Toxic
Specifications
| Ethidium Bromide | |
| 1% Solution | |
| DNase-, RNase- and Protease-Free | |
| MFCD00011724 | |
| ethidium bromide, homidium bromide, dromilac, 3,8-diamino-5-ethyl-6-phenylphenanthridinium bromide, ethydium bromide, 3,8-diamino-5-ethyl-6-phenylphenanthridin-5-ium bromide, etbr, 2,7-diamino-10-ethyl-9-phenylphenanthridinium bromide, 2,7-diamino-9-phenyl-10-ethylphenanthridinium bromide, unii-059nuo2z1l | |
| [Br-].CC[N+]1=C(C2=CC=CC=C2)C2=CC(N)=CC=C2C2=CC=C(N)C=C12 | |
| 394.32 | |
| CHEBI:4883 | |
| Molecular Biology | |
| 10 mL |
| Red | |
| 1239-45-8,7732-18-5 | |
| C21H20BrN3 | |
| 15, 4769 | |
| ZMMJGEGLRURXTF-UHFFFAOYSA-N | |
| 5-ethyl-6-phenylphenanthridin-5-ium-3,8-diamine;bromide | |
| 14710 | |
| 394.33 | |
| Clear Bottle | |
| Liquid |