Learn More
Estriol, 97%, Thermo Scientific™
Supplier: Thermo Scientific Chemicals 460490010
Description
This Thermo Scientific brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Specifications
| Estriol | |
| 0.5% max. | |
| 96% min. (HPLC) | |
| C18H24O3 | |
| estriol, oestriol, estratriol, ovestin, ovestrion, trihydroxyestrin, destriol, tridestrin, aacifemine, oestratriol | |
| PROQIPRRNZUXQM-ZXXIGWHRSA-N | |
| (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol | |
| 5756 | |
| 288.38 |
| 50-27-1 | |
| Authentic | |
| Glass Bottle | |
| 1g | |
| Solubility in water: insoluble. Other solubilities: soluble in methanol | |
| CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O | |
| 288.38 | |
| CHEBI:27974 | |
| 97% |
Chemical Identifiers
| 50-27-1 | |
| 288.38 | |
| estriol, oestriol, estratriol, ovestin, ovestrion, trihydroxyestrin, destriol, tridestrin, aacifemine, oestratriol | |
| CHEBI:27974 | |
| CC12CCC3C(C1CC(C2O)O)CCC4=C3C=CC(=C4)O |
| C18H24O3 | |
| PROQIPRRNZUXQM-ZXXIGWHRSA-N | |
| 5756 | |
| (8R,9S,13S,14S,16R,17R)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,16,17-triol |
Safety and Handling
GHS H Statement
Suspected of causing cancer.
May damage fertility or the unborn child.
GHS P Statement
Obtain special instructions before use.
Use personal protective equipment as required.
IF exposed or concerned: Get medical advice/attention.
GHS Signal Word: Danger
EINECSNumber : 200-022-2
RUO â Research Use Only