missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Esculin hydrate, 97%
CAS: 531-75-9 | C15H16O9 | 340.28 g/mol
$85.97 - $455.34
Chemical Identifiers
| CAS | 531-75-9 |
|---|---|
| Molecular Formula | C15H16O9 |
| Molecular Weight (g/mol) | 340.28 |
| MDL Number | MFCD00149492 |
| InChI Key | XHCADAYNFIFUHF-TYKRLAFXNA-N |
| Synonym | esculin, aesculin, esculoside, --esculin, polychrome, 6,7-dihydroxycoumarin-6-o-glucoside, aesculinum, esculine, esculetin 6-o-glucoside, 6,7-dihydroxycoumarin 6-glucoside |
| PubChem CID | 5281417 |
| ChEBI | CHEBI:4853 |
| IUPAC Name | 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| SMILES | OC[C@H]1O[C@@H](OC2=C(O)C=C3OC(=O)C=CC3=C2)[C@H](O)[C@@H](O)[C@@H]1O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC117830050
|
Thermo Scientific Chemicals
117830050 |
5 g | Glass bottle |
Each for $85.97
|
|
||||
|
AC117830100
|
Thermo Scientific Chemicals
117830100 |
10 g | Glass bottle |
Each for $133.97
|
|
||||
|
AC117830500
|
Thermo Scientific Chemicals
117830500 |
50 g | Glass bottle |
Each for $455.34
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 531-75-9 | |
| 340.28 | |
| XHCADAYNFIFUHF-TYKRLAFXNA-N | |
| 5281417 | |
| 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one |
| C15H16O9 | |
| MFCD00149492 | |
| esculin, aesculin, esculoside, --esculin, polychrome, 6,7-dihydroxycoumarin-6-o-glucoside, aesculinum, esculine, esculetin 6-o-glucoside, 6,7-dihydroxycoumarin 6-glucoside | |
| CHEBI:4853 | |
| OC[C@H]1O[C@@H](OC2=C(O)C=C3OC(=O)C=CC3=C2)[C@H](O)[C@@H](O)[C@@H]1O |
Specifications
| 531-75-9 | |
| Authentic | |
| Glass bottle | |
| MFCD00149492 | |
| 15, 3753 | |
| − 86.00 | |
| Solubility in water: slightly soluble. Other solubilities: freely soluble in hot water,soluble in hot alcohol,methanol,pyridine,,ethyl acetate and acetic acid | |
| OC[C@H]1O[C@@H](OC2=C(O)C=C3OC(=O)C=CC3=C2)[C@H](O)[C@@H](O)[C@@H]1O | |
| 340.28 | |
| CHEBI:4853 | |
| 97% | |
| Esculin hydrate |
| 203.0°C to 205.0°C | |
| 97% | |
| C15H16O9 | |
| 5 g | |
| - 86.00 (20.00°C c=2,dioxane/water1:1) | |
| esculin, aesculin, esculoside, --esculin, polychrome, 6,7-dihydroxycoumarin-6-o-glucoside, aesculinum, esculine, esculetin 6-o-glucoside, 6,7-dihydroxycoumarin 6-glucoside | |
| XHCADAYNFIFUHF-TYKRLAFXNA-N | |
| 7-hydroxy-6-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-2-one | |
| 5281417 | |
| 340.29 | |
| Liquid |
Safety and Handling
EINECSNumber : 208-517-5
RUO – Research Use Only