missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals Ergosterol, 98%
CAS: 57-87-4 | C28H44O | 396.64 g/mol
Supplier: Thermo Scientific Chemicals 117810250
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Specifications
| Ergosterol | |
| 156°C to 158°C | |
| 250°C (1.3 Pa) | |
| 97.5% min. (HPLC) | |
| C28H44O | |
| 25 g | |
| 15, 3716 | |
| -120 | |
| Solubility in water: practically insoluble in water. Other solubilities: soluble in benzene,1g/660 mL alcohol- 1g/45 mL boiling alcohol,1g/70 mL ether- 1g/39 mL boiling ether,1g/31 mL chloroform | |
| CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C | |
| 396.64 | |
| CHEBI:16933 | |
| 98% |
| 57-87-4 | |
| White | |
| Authentic | |
| Glass bottle | |
| MFCD00003623 | |
| 06,III,3099 | |
| −120.00 (20.00°C c=1,CHC13) | |
| ergosterol, provitamin d2, unii-z30ray509f, ergosterin, ergosta-5,7,22e-trien-3beta-ol, 5,7,22-ergostatrien-3beta-ol, 3beta-hydroxy-5,7,22-ergostatriene, 22e,24s-24-methylcholesta-5,7,22-trien-3beta-ol, 22e-ergosta-5,7,22-trien-3beta-ol, ergosta-5,7,22-trien-3-ol, 3b,22e | |
| DNVPQKQSNYMLRS-APGDWVJJSA-N | |
| (3S,9S,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol | |
| 444679 | |
| 396.64 | |
| Crystalline Powder or Crystalline Needles |
Chemical Identifiers
| 57-87-4 | |
| 396.64 | |
| DNVPQKQSNYMLRS-APGDWVJJSA-N | |
| 444679 | |
| (3S,9S,10R,13R,14R,17R)-17-[(E,2R,5R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| C28H44O | |
| MFCD00003623 | |
| ergosterol, provitamin d2, unii-z30ray509f, ergosterin, ergosta-5,7,22e-trien-3beta-ol, 5,7,22-ergostatrien-3beta-ol, 3beta-hydroxy-5,7,22-ergostatriene, 22e,24s-24-methylcholesta-5,7,22-trien-3beta-ol, 22e-ergosta-5,7,22-trien-3beta-ol, ergosta-5,7,22-trien-3-ol, 3b,22e | |
| CHEBI:16933 | |
| CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
Safety and Handling
EINECSNumber : 200-352-7
RUO – Research Use Only