missing translation for 'onlineSavingsMsg'
Learn More
Learn More
MilliporeSigma™ EGTA, Molecular Biology Grade, Calbiochem™,
Supplier: MilliporeSigma™ 32462625GM
Specifications
| EGTA | |
| White | |
| C14H24N2O10 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O | |
| 380.35 | |
| CHEBI:30740 | |
| ≥98% |
| 67-42-5 | |
| Molecular biology grade | |
| 25 g | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid | |
| 6207 | |
| 380.4 | |
| Fine Solid |
Chemical Identifiers
| 67-42-5 | |
| 380.35 | |
| egta, egtazic acid, gedta, ethylenebis oxyethylenenitrilo tetraacetic acid, ebonta, 6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl, 1,2-bis 2-bis carboxymethyl amino ethoxy ethane, ethylene glycol tetraacetic acid, h4egta, egtazic acid usan:inn | |
| CHEBI:30740 | |
| C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| C14H24N2O10 | |
| DEFVIWRASFVYLL-UHFFFAOYSA-N | |
| 6207 | |
| 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
Safety and Handling
RTECSNumber : AH3760000
Recommended Storage : 15° to 30°C (59° to 86°F); Keep container tightly closed. Keep container in a cool, well-ventilated area. Do not store above 20°C (68°F)