missing translation for 'onlineSavingsMsg'
Learn More
Learn More
EDTA disodium salt concentrate, For 1L standard solution, 0.1Â M EDTA-Na2, for complexometry, Honeywell Fluka™
for 1L standard solution, 0.1Â M EDTA-Na2, for complexometry
$136.71 - $715.24
Chemical Identifiers
| CAS | 139-33-3 |
|---|---|
| Molecular Formula | C10H14N2Na2O8 |
| Molecular Weight (g/mol) | 336.21 |
| MDL Number | MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 |
| InChI Key | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| PubChem CID | 57339238 |
| ChEBI | CHEBI:64734 |
| IUPAC Name | disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
Description
- Leading the Industry For Over 65 Years
- Honeywell now delivers Fluka™ premium grade inorganic reagents worldwide – with consistency, purity, and accuracy assured
Chemical Identifiers
| 139-33-3 | |
| 336.21 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| CHEBI:64734 | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| 57339238 | |
| disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate |
Specifications
| 139-33-3 | |
| C10H14N2Na2O8 | |
| MFCD00070672,MFCD00003541,MFCD00070672,MFCD00150037 | |
| 3822669 | |
| ZGTMUACCHSMWAC-UHFFFAOYSA-L | |
| disodium;2-[2-[bis(carboxylatomethyl)azaniumyl]ethyl-(carboxylatomethyl)azaniumyl]acetate | |
| 57339238 | |
| 336.21g/mol | |
| Ethylenediaminetetraacetic acid disodium salt concentrate |
| 1 Pc. | |
| [-CH2N(CH2CO2Na)CH2CO2H]2 | |
| UN3265 | |
| ethylenediaminetetraacetic acid disodium salt, edta na2, disodium 2-2-bis carboxymethyl amino ethyl-carboxymethyl amino acetic acid | |
| [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O | |
| 336.21 | |
| CHEBI:64734 | |
| Ampoule |
Safety and Handling
P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338
ShelfLife : 1260 days from date of manufacture
DOTInformation : 8 / PGII
Recommended Storage : Room Temp