Learn More
Ecdysterone
An insect steroid hormone that induces apoptosis | CAS: 5289-74-7 | C27H44O7 | 480.64 g/mol
Supplier: Thermo Scientific Chemicals J63091MA
| Quantity | 10 mg |
|---|
Description
Ecdysterone is an insect steroid hormone that induces apoptosis, cell proliferation, growth by controlling gene expression involved in molting and metamorphosis. And it is also used as a ecdysteroid in both plant and animal species that controls cell death.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
ApplicationsEcdysterone is an insect steroid hormone that induces apoptosis, cell proliferation, growth by controlling gene expression involved in molting and metamorphosis. And it is also used as a ecdysteroid in both plant and animal species that controls cell death.
Solubility
Soluble in alcohol
Notes
Keep container tightly closed. Store away from oxidizing agents.
Chemical Identifiers
| 5289-74-7 | |
| 480.64 | |
| NKDFYOWSKOHCCO-YPVLXUMRSA-N | |
| 5459840 | |
| (1S,3aS,5aR,7R,8S,9aR,9bR,11aR)-3a,7,8-trihydroxy-9a,11a-dimethyl-1-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1H,2H,3H,3aH,5H,5aH,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-5-one |
| C27H44O7 | |
| MFCD00036740 | |
| 20-hydroxyecdysone, ecdysterone, beta-ecdysone, crustecdysone, 20-oh ecdysone, the-7, polypodine a, insect moulting hormone, commisterone, crustecdyson | |
| CHEBI:16587 | |
| CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
Specifications
| Ecdysterone | |
| 242°C to 244°C | |
| C27H44O7 | |
| MFCD00036740 | |
| 14,3491 | |
| Soluble in alcohol | |
| CC(C)(O)CC[C@@H](O)[C@](C)(O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C | |
| 480.64 | |
| CHEBI:16587 | |
| Powder |
| 5289-74-7 | |
| White | |
| 10 mg | |
| 1917578 | |
| 20-hydroxyecdysone, ecdysterone, beta-ecdysone, crustecdysone, 20-oh ecdysone, the-7, polypodine a, insect moulting hormone, commisterone, crustecdyson | |
| NKDFYOWSKOHCCO-YPVLXUMRSA-N | |
| (1S,3aS,5aR,7R,8S,9aR,9bR,11aR)-3a,7,8-trihydroxy-9a,11a-dimethyl-1-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1H,2H,3H,3aH,5H,5aH,6H,7H,8H,9H,9aH,9bH,10H,11H,11aH-cyclopenta[a]phenanthren-5-one | |
| 5459840 | |
| 480.64 |
Safety and Handling
RTECSNumber : FZ8060000
TSCA : No
Recommended Storage : Store at -20°C