Learn More
Doxycycline Hydrochloride (Yellow Powder), Fisher BioReagents™
Broad spectrum antibiotic
Supplier: Fisher BioReagents BP26535
| Quantity | 5 g |
|---|---|
| Packaging | Amber Glass |
Description
Broad spectrum antibiotic
Broad spectrum antibiotic. Broad spectrum inhibitor of matrix metalloproteinases in vivo.Chemical Identifiers
| 10592-13-9 | |
| 480.90 | |
| VLUQVUWDECWBTL-UQVCFKGQSA-N | |
| [(1S,4aR,11R,11aR,12S,12aR)-3-carbamoyl-4,4a,6,7,12-pentahydroxy-11-methyl-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-dimethylazanium;chloride |
| C22H25ClN2O8 | |
| MFCD03427564 | |
| 54706018 | |
| [Cl-].C[C@@H]1[C@H]2[C@H](O)[C@H]3[C@H]([NH+](C)C)C(=O)\C(=C(/N)O)C(=O)[C@@]3(O)C(=O)C2=C(O)C2=C(O)C=CC=C12 |
Specifications
| Doxycycline Hydrochloride | |
| Powder/Solid | |
| 10592-13-9 | |
| Amber Glass | |
| Inclusive between 105° | |
| Yellow | |
| 95% | |
| MFCD03427564 | |
| [Cl-].C[C@@H]1[C@H]2[C@H](O)[C@H]3[C@H]([NH+](C)C)C(=O)\C(=C(/N)O)C(=O)[C@@]3(O)C(=O)C2=C(O)C2=C(O)C=CC=C12 | |
| 480.90 | |
| 480.9 |
| Doxycycline Hydrochloride | |
| Inclusive between 300 at 349nm | |
| 210°C | |
| Inclusive between 800μg/mg | |
| Inclusive between 1.4% | |
| 5 g | |
| C22H25ClN2O8 | |
| VLUQVUWDECWBTL-UQVCFKGQSA-N | |
| [(1S,4aR,11R,11aR,12S,12aR)-3-carbamoyl-4,4a,6,7,12-pentahydroxy-11-methyl-2,5-dioxo-11,11a,12,12a-tetrahydro-1H-tetracen-1-yl]-dimethylazanium;chloride | |
| 54706018 |
Safety and Handling
WARNING!
Emergency Overview
Harmful by inhalation, in contact with skin and if swallowed. Use personal protective equipment. Use only under a chemical fume hood. Wash off immediately with plenty of water for at least 15 minutes. Immediate medical attention is required. Rinse immediately with plenty of water, also under the eyelids, for at least 15 minutes. Immediate medical attention is required. Move to fresh air. Do not use mouth-to-mouth resuscitation if victim ingested or inhaled the substance; induce artifici. Do not induce vomiting. Call a physician or Poison Control Center immediately. . .
NFPA
Health:2
Flammability:0
Instability:0
Recommended Storage : 0° to 5°C, light sensitive, desiccate.