missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Thermo Scientific Chemicals DL-Threonine, 99.5%
CAS: 80-68-2 | C4H9NO3 | 119.12 g/mol
$134.39 - $1340.19
Chemical Identifiers
| CAS | 80-68-2 |
|---|---|
| Molecular Formula | C4H9NO3 |
| Molecular Weight (g/mol) | 119.12 |
| MDL Number | MFCD00063722 |
| InChI Key | AYFVYJQAPQTCCC-PWNYCUMCSA-N |
| Synonym | dl-threonine, allo-dl-threonine, threonine, dl, dl-allothreonine, dl-2-amino-3-hydroxybutanoic acid, threonine l, h-dl-thr-oh, dl-allo-threonine, allothreonine, d, wln: qy1&yzvq-l |
| PubChem CID | 205 |
| ChEBI | CHEBI:38263 |
| SMILES | C[C@@H](O)[C@@H](N)C(O)=O |
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|---|---|---|---|---|---|---|---|---|---|
| Catalog Number | Mfr. No. | Quantity | Packaging | Price | Quantity | ||||
|
AC138940250
|
Thermo Scientific Chemicals
138940250 |
25 g | Glass Bottle |
Each for $134.39
|
|
||||
|
AC138941000
|
Thermo Scientific Chemicals
138941000 |
100 g | Glass Bottle |
Each for $313.02
|
|
||||
|
AC138945000
|
Thermo Scientific Chemicals
138945000 |
500 g | Glass Bottle |
Each for $1,340.19
|
|
||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Chemical Identifiers
| 80-68-2 | |
| 119.12 | |
| AYFVYJQAPQTCCC-PWNYCUMCSA-N | |
| 205 | |
| C[C@@H](O)[C@@H](N)C(O)=O |
| C4H9NO3 | |
| MFCD00063722 | |
| dl-threonine, allo-dl-threonine, threonine, dl, dl-allothreonine, dl-2-amino-3-hydroxybutanoic acid, threonine l, h-dl-thr-oh, dl-allo-threonine, allothreonine, d, wln: qy1&yzvq-l | |
| CHEBI:38263 |
Specifications
| 80-68-2 | |
| White | |
| 10ppm max. | |
| 0.2% max. (1 g, 105°C, 3 hrs) | |
| (TLC) Passes Test | |
| Glass Bottle | |
| MFCD00063722 | |
| 10, 9229 | |
| dl-threonine, allo-dl-threonine, threonine, dl, dl-allothreonine, dl-2-amino-3-hydroxybutanoic acid, threonine l, h-dl-thr-oh, dl-allo-threonine, allothreonine, d, wln: qy1&yzvq-l | |
| C[C@@H](O)[C@@H](N)C(O)=O | |
| 119.12 | |
| 205 | |
| 119.12 | |
| Crystalline Powder or Crystals |
| 2ppm max. | |
| 200ppm max. | |
| Authentic | |
| 99.5% | |
| C4H9NO3 | |
| CH3CH(OH)CH(NH2)CO2H | |
| 04, 514 | |
| 0.1% max. | |
| AYFVYJQAPQTCCC-PWNYCUMCSA-N | |
| (2R,3R)-2-amino-3-hydroxybutanoic acid | |
| 25 g | |
| CHEBI:38263 | |
| 98.0 to 101.0% (on dried substance) | |
| DL-Threonine |
RUO – Research Use Only